Products 2221812-00-4

CAS 2221812-00-4 is the registry number for 2-(3-Bromo-6-chloro-2-fluorophenyl)-1,3-dioxolane, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(3-bromo-6-chloro-2-fluorophenyl)-1,3-dioxolane (CAS 2221812-00-4) is a chemical compound with the molecular formula C9H7BrClFO2 and a molecular weight of 281.50 g/mol. IUPAC name: 2-(3-bromo-6-chloro-2-fluorophenyl)-1,3-dioxolane. InChIKey: WFNXMVHVZCEFLO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7BrClFO2
Molecular weight281.50 g/mol
IUPAC name2-(3-bromo-6-chloro-2-fluorophenyl)-1,3-dioxolane
InChIKeyWFNXMVHVZCEFLO-UHFFFAOYSA-N
SMILESC1COC(O1)C2=C(C=CC(=C2F)Br)Cl

Computed by PubChem (NCBI)