Products 1505736-62-8
CAS 1505736-62-8 is the registry number for 1-(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)cyclobutanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclobutan-1-ol (CAS 1505736-62-8) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclobutan-1-ol. InChIKey: NCZWNCXAWCFSCP-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclobutan-1-ol |
| InChIKey | NCZWNCXAWCFSCP-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC3=C(C=C2)OCCO3)O |
Computed by PubChem (NCBI)