CAS 1506034-25-8 appears in our catalog under these names: 1-(3-Amino-4-bromophenyl)-3,3-dimethylpyrrolidine-2,5-dione, 95%, 1-(3-Amino-4-bromophenyl)-3,3-dimethylpyrrolidine-2,5-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(3-amino-4-bromophenyl)-3,3-dimethylpyrrolidine-2,5-dione (CAS 1506034-25-8) is a chemical compound with the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. IUPAC name: 1-(3-amino-4-bromophenyl)-3,3-dimethylpyrrolidine-2,5-dione. InChIKey: SNJLLJOFFXTAJJ-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O2 |
|---|---|
| Molecular weight | 297.15 g/mol |
| IUPAC name | 1-(3-amino-4-bromophenyl)-3,3-dimethylpyrrolidine-2,5-dione |
| InChIKey | SNJLLJOFFXTAJJ-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)N(C1=O)C2=CC(=C(C=C2)Br)N)C |
Computed by PubChem (NCBI)