Products 1506203-60-6

CAS 1506203-60-6 is the registry number for 5,6-Dimethylchromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5,6-dimethyl-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1506203-60-6) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 5,6-dimethyl-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: ROJYTTXJTWJPFX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O3
Molecular weight206.24 g/mol
IUPAC name5,6-dimethyl-3,4-dihydro-2H-chromene-3-carboxylic acid
InChIKeyROJYTTXJTWJPFX-UHFFFAOYSA-N
SMILESCC1=C(C2=C(C=C1)OCC(C2)C(=O)O)C

Computed by PubChem (NCBI)