Products 1506431-11-3

CAS 1506431-11-3 is the registry number for 3-(2-(tert-butoxy)-2-oxoethyl)cyclobutane-1-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]cyclobutane-1-carboxylic acid (CAS 1506431-11-3) is a chemical compound with the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. IUPAC name: 3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]cyclobutane-1-carboxylic acid. InChIKey: ZNUHNXJFVFZURM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18O4
Molecular weight214.26 g/mol
IUPAC name3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]cyclobutane-1-carboxylic acid
InChIKeyZNUHNXJFVFZURM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CC1CC(C1)C(=O)O

Computed by PubChem (NCBI)