CAS 847416-52-8 appears in our catalog under these names: cis-3-tert-Butoxycarbonylmethyl-cyclobutanecarboxylic acid, 97%, (1s,3s)-3-(2-(tert-butoxy)-2-oxoethyl)cyclobutane-1-carboxylic acid, cis, cis-3-[2-(tert-Butoxy)-2-oxoethyl]cyclobutanecarboxylic Acid, 95%, 95%, (1s,3s)-3-(2-(tert-butoxy)-2-oxoethyl)cyclobutanecarboxylic acid, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 1g, 250mg.
3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]cyclobutane-1-carboxylic acid (CAS 847416-52-8) is a chemical compound with the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. IUPAC name: 3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]cyclobutane-1-carboxylic acid. InChIKey: ZNUHNXJFVFZURM-UHFFFAOYSA-N.
| Molecular formula | C11H18O4 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]cyclobutane-1-carboxylic acid |
| InChIKey | ZNUHNXJFVFZURM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1CC(C1)C(=O)O |
Computed by PubChem (NCBI)