CAS 1506512-05-5 is the registry number for 4-{((tert-Butoxy)carbonyl)amino}-1-methyl-1H-pyrazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-5-carboxylic acid (CAS 1506512-05-5) is a chemical compound with the molecular formula C10H15N3O4 and a molecular weight of 241.24 g/mol. IUPAC name: 1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-5-carboxylic acid. InChIKey: NDAGCIJPZHOZPG-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O4 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-5-carboxylic acid |
| InChIKey | NDAGCIJPZHOZPG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(N(N=C1)C)C(=O)O |
Computed by PubChem (NCBI)