Products 150693-65-5
CAS 150693-65-5 is the registry number for Lagunamycin. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
6-diazo-4-[(E)-4,6-dimethylhept-2-en-2-yl]-3-methyl-1H-quinoline-2,5,7,8-tetrone (CAS 150693-65-5) is a chemical compound with the molecular formula C19H21N3O4 and a molecular weight of 355.4 g/mol. IUPAC name: 6-diazo-4-[(E)-4,6-dimethylhept-2-en-2-yl]-3-methyl-1H-quinoline-2,5,7,8-tetrone. InChIKey: PJKDXVRDJPKOHU-JXMROGBWSA-N.
| Molecular formula | C19H21N3O4 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 6-diazo-4-[(E)-4,6-dimethylhept-2-en-2-yl]-3-methyl-1H-quinoline-2,5,7,8-tetrone |
| InChIKey | PJKDXVRDJPKOHU-JXMROGBWSA-N |
| SMILES | CC1=C(C2=C(C(=O)C(=O)C(=[N+]=[N-])C2=O)NC1=O)/C(=C/C(C)CC(C)C)/C |
Computed by PubChem (NCBI)