CAS 2924858-26-2 is the registry number for 5-Aminothalidomide-cyclohexane. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(cyclohexylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 2924858-26-2) is a chemical compound with the molecular formula C19H21N3O4 and a molecular weight of 355.4 g/mol. IUPAC name: 5-(cyclohexylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: SXAAQKYUBIMDRM-UHFFFAOYSA-N.
| Molecular formula | C19H21N3O4 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 5-(cyclohexylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | SXAAQKYUBIMDRM-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC2=CC3=C(C=C2)C(=O)N(C3=O)C4CCC(=O)NC4=O |
Computed by PubChem (NCBI)