CAS 5513-69-9 appears in our catalog under these names: Z-Gly-phe-nh2, 97%, Z–Gly–Phe–NH2, Z–Gly–Phe–NH₂, Z-Gly-Phe-NH2. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 5g, 25g, 1g, 0,1g.
Benzyl N-[2-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]carbamate (CAS 5513-69-9) is a chemical compound with the molecular formula C19H21N3O4 and a molecular weight of 355.4 g/mol. IUPAC name: benzyl N-[2-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]carbamate. InChIKey: QGZDXQHLEQAGJB-INIZCTEOSA-N.
| Molecular formula | C19H21N3O4 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | benzyl N-[2-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]carbamate |
| InChIKey | QGZDXQHLEQAGJB-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N)NC(=O)CNC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)