Products 1507108-83-9

CAS 1507108-83-9 is the registry number for 5-Hydroxyspiro(2.3)hexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-hydroxyspiro[2.3]hexane-2-carboxylic acid (CAS 1507108-83-9) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: 5-hydroxyspiro[2.3]hexane-2-carboxylic acid. InChIKey: VRBUBZDHZFDTMY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10O3
Molecular weight142.15 g/mol
IUPAC name5-hydroxyspiro[2.3]hexane-2-carboxylic acid
InChIKeyVRBUBZDHZFDTMY-UHFFFAOYSA-N
SMILESC1C(CC12CC2C(=O)O)O

Computed by PubChem (NCBI)