Products 1507487-02-6
CAS 1507487-02-6 is the registry number for 2-(3,4-Dimethyl-2,5-dioxopyrrolidin-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)acetic acid (CAS 1507487-02-6) is a chemical compound with the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. IUPAC name: 2-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)acetic acid. InChIKey: HKLUUCPPHRXGEY-UHFFFAOYSA-N.
| Molecular formula | C8H11NO4 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 2-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)acetic acid |
| InChIKey | HKLUUCPPHRXGEY-UHFFFAOYSA-N |
| SMILES | CC1C(C(=O)N(C1=O)CC(=O)O)C |
Computed by PubChem (NCBI)