Products 1507736-73-3

CAS 1507736-73-3 is the registry number for tert-Butyl N-((3-amino-1-methyl-1H-pyrazol-4-yl)methyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(3-amino-1-methylpyrazol-4-yl)methyl]carbamate (CAS 1507736-73-3) is a chemical compound with the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. IUPAC name: tert-butyl N-[(3-amino-1-methylpyrazol-4-yl)methyl]carbamate. InChIKey: AOJKMJYMNLUUTA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18N4O2
Molecular weight226.28 g/mol
IUPAC nametert-butyl N-[(3-amino-1-methylpyrazol-4-yl)methyl]carbamate
InChIKeyAOJKMJYMNLUUTA-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCC1=CN(N=C1N)C

Computed by PubChem (NCBI)