CAS 150831-14-4 appears in our catalog under these names: Iguratimod Impurity 24, Iguratimod Impurity 16 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-(2-aminoacetyl)-5-hydroxy-2-phenoxyphenyl]methanesulfonamide (CAS 150831-14-4) is a chemical compound with the molecular formula C15H16N2O5S and a molecular weight of 336.4 g/mol. IUPAC name: N-[4-(2-aminoacetyl)-5-hydroxy-2-phenoxyphenyl]methanesulfonamide. InChIKey: MFFYKQKTQWZYPF-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O5S |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | N-[4-(2-aminoacetyl)-5-hydroxy-2-phenoxyphenyl]methanesulfonamide |
| InChIKey | MFFYKQKTQWZYPF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=C(C(=C1)O)C(=O)CN)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)