CAS 2109155-94-2 is the registry number for 1-(1,1-Dioxidotetrahydro-3-thienyl)-3-(4-methoxyphenyl)-1h-pyrazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(1,1-dioxothiolan-3-yl)-3-(4-methoxyphenyl)pyrazole-5-carboxylic acid (CAS 2109155-94-2) is a chemical compound with the molecular formula C15H16N2O5S and a molecular weight of 336.4 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)-3-(4-methoxyphenyl)pyrazole-5-carboxylic acid. InChIKey: NNBJCFVCJZATDT-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O5S |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 1-(1,1-dioxothiolan-3-yl)-3-(4-methoxyphenyl)pyrazole-5-carboxylic acid |
| InChIKey | NNBJCFVCJZATDT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NN(C(=C2)C(=O)O)C3CCS(=O)(=O)C3 |
Computed by PubChem (NCBI)