CAS 680591-44-0 is the registry number for N-(6-Methoxy-3-pyridinyl)-N-((2-methylphenyl)sulfonyl)glycine. Offered by: TRC. Available pack sizes: 100mg.
2-[(6-methoxy-3-pyridinyl)-(2-methylphenyl)sulfonylamino]acetic acid (CAS 680591-44-0) is a chemical compound with the molecular formula C15H16N2O5S and a molecular weight of 336.4 g/mol. IUPAC name: 2-[(6-methoxy-3-pyridinyl)-(2-methylphenyl)sulfonylamino]acetic acid. InChIKey: MQCMHESYTKWLGP-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O5S |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 2-[(6-methoxy-3-pyridinyl)-(2-methylphenyl)sulfonylamino]acetic acid |
| InChIKey | MQCMHESYTKWLGP-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1S(=O)(=O)N(CC(=O)O)C2=CN=C(C=C2)OC |
Computed by PubChem (NCBI)