Products 1508347-71-4
CAS 1508347-71-4 is the registry number for N5,N5-Dimethylbenzo[d]oxazole-2,5-diamine, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
5-N,5-N-dimethyl-1,3-benzoxazole-2,5-diamine (CAS 1508347-71-4) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 5-N,5-N-dimethyl-1,3-benzoxazole-2,5-diamine. InChIKey: HAJOTXYWUKZOLC-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 5-N,5-N-dimethyl-1,3-benzoxazole-2,5-diamine |
| InChIKey | HAJOTXYWUKZOLC-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)OC(=N2)N |
Computed by PubChem (NCBI)