CAS 15087-24-8 appears in our catalog under these names: Benzylidenecamphor, 3-Benzylidenecamphor, >95% (HPLC), 3-Benzylidenecamphor, 1,7,7-Trimethyl-3-(phenylmethylene)bicyclo[2.2.1]heptan-2-one, 95%, 95%, Benzylidene camphor. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Sigma-Aldrich, Chemat. Available pack sizes: on request, 1g, 250mg, 50mg, 25MG, 10mg, 100mg, 500mg.
3-benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (CAS 15087-24-8) is a chemical compound with the molecular formula C17H20O and a molecular weight of 240.34 g/mol. IUPAC name: 3-benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one. InChIKey: OIQXFRANQVWXJF-UHFFFAOYSA-N.
| Molecular formula | C17H20O |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | 3-benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| InChIKey | OIQXFRANQVWXJF-UHFFFAOYSA-N |
| SMILES | CC1(C2CCC1(C(=O)C2=CC3=CC=CC=C3)C)C |
Computed by PubChem (NCBI)