Products 1609538-16-0
CAS 1609538-16-0 is the registry number for 3-(tert-Butyl)-4'-methyl-(1,1'-biphenyl)-4-ol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-tert-butyl-4-(4-methylphenyl)phenol (CAS 1609538-16-0) is a chemical compound with the molecular formula C17H20O and a molecular weight of 240.34 g/mol. IUPAC name: 2-tert-butyl-4-(4-methylphenyl)phenol. InChIKey: MWXYQNUGONRDPF-UHFFFAOYSA-N.
| Molecular formula | C17H20O |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | 2-tert-butyl-4-(4-methylphenyl)phenol |
| InChIKey | MWXYQNUGONRDPF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=C(C=C2)O)C(C)(C)C |
Computed by PubChem (NCBI)