Products 887340-16-1

CAS 887340-16-1 is the registry number for 3-(tert-Butyl)-3'-methyl-(1,1'-biphenyl)-4-ol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-tert-butyl-4-(3-methylphenyl)phenol (CAS 887340-16-1) is a chemical compound with the molecular formula C17H20O and a molecular weight of 240.34 g/mol. IUPAC name: 2-tert-butyl-4-(3-methylphenyl)phenol. InChIKey: SHNFHFYHZCSNGT-UHFFFAOYSA-N.

Identity
Molecular formulaC17H20O
Molecular weight240.34 g/mol
IUPAC name2-tert-butyl-4-(3-methylphenyl)phenol
InChIKeySHNFHFYHZCSNGT-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)C2=CC(=C(C=C2)O)C(C)(C)C

Computed by PubChem (NCBI)