Products 1509721-41-8
CAS 1509721-41-8 is the registry number for 5-(2,3-Dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-amine (CAS 1509721-41-8) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 5-(2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-amine. InChIKey: HLJWYTUUSRYDCU-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 5-(2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-amine |
| InChIKey | HLJWYTUUSRYDCU-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C3=CC(=NO3)N |
Computed by PubChem (NCBI)