CAS 1509890-90-7 appears in our catalog under these names: N4-((4-Chlorophenyl)methyl)quinazoline-2,4-diamine, 95%, N4-((4-Chlorophenyl)methyl)quinazoline-2,4-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-N-[(4-chlorophenyl)methyl]quinazoline-2,4-diamine (CAS 1509890-90-7) is a chemical compound with the molecular formula C15H13ClN4 and a molecular weight of 284.74 g/mol. IUPAC name: 4-N-[(4-chlorophenyl)methyl]quinazoline-2,4-diamine. InChIKey: OGLCWGIUVQHPPS-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN4 |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | 4-N-[(4-chlorophenyl)methyl]quinazoline-2,4-diamine |
| InChIKey | OGLCWGIUVQHPPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)N)NCC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)