Products 151028-23-8
CAS 151028-23-8 is the registry number for 1-(tert-Butyl) 5-methyl (S)-2-((tert-butoxycarbonyl)amino)-4-methylenepentanedioate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-O-tert-butyl 1-O-methyl (4S)-2-methylidene-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (CAS 151028-23-8) is a chemical compound with the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. IUPAC name: 5-O-tert-butyl 1-O-methyl (4S)-2-methylidene-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate. InChIKey: SBPOVQCHHAKWCF-NSHDSACASA-N.
| Molecular formula | C16H27NO6 |
|---|---|
| Molecular weight | 329.39 g/mol |
| IUPAC name | 5-O-tert-butyl 1-O-methyl (4S)-2-methylidene-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| InChIKey | SBPOVQCHHAKWCF-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC(=C)C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)