Products 848070-26-8

CAS 848070-26-8 is the registry number for 1-(tert-Butyl) 4,4-diethyl piperidine-1,4,4-tricarboxylate 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 4-O,4-O'-diethyl piperidine-1,4,4-tricarboxylate (CAS 848070-26-8) is a chemical compound with the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. IUPAC name: 1-O-tert-butyl 4-O,4-O'-diethyl piperidine-1,4,4-tricarboxylate. InChIKey: UOEYKNPDPRQKCE-UHFFFAOYSA-N.

Identity
Molecular formulaC16H27NO6
Molecular weight329.39 g/mol
IUPAC name1-O-tert-butyl 4-O,4-O'-diethyl piperidine-1,4,4-tricarboxylate
InChIKeyUOEYKNPDPRQKCE-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)C(=O)OCC

Computed by PubChem (NCBI)