CAS 149880-80-8 is the registry number for (2R,3S)-1,2-Bis(tert-butoxycarbonyl)piperidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S)-1,2-bis[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 149880-80-8) is a chemical compound with the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. IUPAC name: (2R,3S)-1,2-bis[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: ZGDPOWSHLXIJBM-WDEREUQCSA-N.
| Molecular formula | C16H27NO6 |
|---|---|
| Molecular weight | 329.39 g/mol |
| IUPAC name | (2R,3S)-1,2-bis[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | ZGDPOWSHLXIJBM-WDEREUQCSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H]1[C@H](CCCN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)