Products 1955524-38-5
CAS 1955524-38-5 is the registry number for 1,4-Bis((tert-butoxy)carbonyl)piperidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 1955524-38-5) is a chemical compound with the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. IUPAC name: 1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: RBASNIDERRGEFR-UHFFFAOYSA-N.
| Molecular formula | C16H27NO6 |
|---|---|
| Molecular weight | 329.39 g/mol |
| IUPAC name | 1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | RBASNIDERRGEFR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)