CAS 151075-21-7 is the registry number for Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate (CAS 151075-21-7) is a chemical compound with the molecular formula C14H23BO4 and a molecular weight of 266.14 g/mol. IUPAC name: methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate. InChIKey: IOOXJFDGINSDEG-UHFFFAOYSA-N.
| Molecular formula | C14H23BO4 |
|---|---|
| Molecular weight | 266.14 g/mol |
| IUPAC name | methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-ene-1-carboxylate |
| InChIKey | IOOXJFDGINSDEG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCC(C2)C(=O)OC |
Computed by PubChem (NCBI)