Products 870778-89-5
CAS 870778-89-5 appears in our catalog under these names: 2,4–Dibutoxyphenylboronic Acid (contains varying amounts of Anhydride), 2,4-Dibutoxyphenylboronic Acid (contains varying amounts of Anhydride), (2,4-Dibutoxyphenyl)boronic acid 97%, 2,4-DIBUTOXYPHENYLBORONIC ACID, 97%, 97%, (2,4-Dibutoxyphenyl)boronic acid, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g.
(2,4-dibutoxyphenyl)boronic acid (CAS 870778-89-5) is a chemical compound with the molecular formula C14H23BO4 and a molecular weight of 266.14 g/mol. IUPAC name: (2,4-dibutoxyphenyl)boronic acid. InChIKey: RZGMDQYKUFKOMM-UHFFFAOYSA-N.
| Molecular formula | C14H23BO4 |
|---|---|
| Molecular weight | 266.14 g/mol |
| IUPAC name | (2,4-dibutoxyphenyl)boronic acid |
| InChIKey | RZGMDQYKUFKOMM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCCCC)OCCCC)(O)O |
Computed by PubChem (NCBI)