CAS 1449522-51-3 appears in our catalog under these names: Methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-1-ene-1-carboxylate, 98%, 2-(Methoxycarbonyl)-1-cyclohexene-1-boronic Acid Pinacol Ester, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 250mg.
Methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexene-1-carboxylate (CAS 1449522-51-3) is a chemical compound with the molecular formula C14H23BO4 and a molecular weight of 266.14 g/mol. IUPAC name: methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexene-1-carboxylate. InChIKey: MTRUKXSEUJSVMO-UHFFFAOYSA-N.
| Molecular formula | C14H23BO4 |
|---|---|
| Molecular weight | 266.14 g/mol |
| IUPAC name | methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexene-1-carboxylate |
| InChIKey | MTRUKXSEUJSVMO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(CCCC2)C(=O)OC |
Computed by PubChem (NCBI)