CAS 1449662-73-0 is the registry number for Ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopent-3-ene-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopent-3-ene-1-carboxylate (CAS 1449662-73-0) is a chemical compound with the molecular formula C14H23BO4 and a molecular weight of 266.14 g/mol. IUPAC name: ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopent-3-ene-1-carboxylate. InChIKey: NQDQOMMNFDVLDG-UHFFFAOYSA-N.
| Molecular formula | C14H23BO4 |
|---|---|
| Molecular weight | 266.14 g/mol |
| IUPAC name | ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopent-3-ene-1-carboxylate |
| InChIKey | NQDQOMMNFDVLDG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC(C2)C(=O)OCC |
Computed by PubChem (NCBI)