Products 1510797-92-8
CAS 1510797-92-8 is the registry number for 1-(4-Chlorophenyl)-4-(methylamino)-2-piperidinone, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(4-chlorophenyl)-4-(methylamino)piperidin-2-one (CAS 1510797-92-8) is a chemical compound with the molecular formula C12H15ClN2O and a molecular weight of 238.71 g/mol. IUPAC name: 1-(4-chlorophenyl)-4-(methylamino)piperidin-2-one. InChIKey: BWXFCNLXGVMVLK-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-4-(methylamino)piperidin-2-one |
| InChIKey | BWXFCNLXGVMVLK-UHFFFAOYSA-N |
| SMILES | CNC1CCN(C(=O)C1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)