CAS 1510832-66-2 appears in our catalog under these names: (3S,4S)-3-Aminopiperidin-4-ol dihydrochloride, 95%, (3S,4S)-3-AMINOPIPERIDIN-4-OL DIHYDROCHLORIDE, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g, 10g.
(3S,4S)-3-aminopiperidin-4-ol;dihydrochloride (CAS 1510832-66-2) is a chemical compound with the molecular formula C5H14Cl2N2O and a molecular weight of 189.08 g/mol. IUPAC name: (3S,4S)-3-aminopiperidin-4-ol;dihydrochloride. InChIKey: SJLRDSYIJUETQL-RSLHMRQOSA-N.
| Molecular formula | C5H14Cl2N2O |
|---|---|
| Molecular weight | 189.08 g/mol |
| IUPAC name | (3S,4S)-3-aminopiperidin-4-ol;dihydrochloride |
| InChIKey | SJLRDSYIJUETQL-RSLHMRQOSA-N |
| SMILES | C1CNC[C@@H]([C@H]1O)N.Cl.Cl |
Computed by PubChem (NCBI)