Products 1511014-66-6

CAS 1511014-66-6 is the registry number for 6-Ethylchromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-ethyl-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1511014-66-6) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 6-ethyl-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: MMLHTMFFIJTKHG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O3
Molecular weight206.24 g/mol
IUPAC name6-ethyl-3,4-dihydro-2H-chromene-3-carboxylic acid
InChIKeyMMLHTMFFIJTKHG-UHFFFAOYSA-N
SMILESCCC1=CC2=C(C=C1)OCC(C2)C(=O)O

Computed by PubChem (NCBI)