CAS 151157-51-6 appears in our catalog under these names: 3,3-Dimethyl-1-phenylcyclobutane-1-carboxylic acid, 97%, 3,3-Dimethyl-1-phenylcyclobutane-1-carboxylic acid, 3,3-Dimethyl-1-phenylcyclobutane-1-carboxylic acid, 97%, 97%, 3,3-DIMETHYL-1-PHENYL-CYCLOBUTANECARBOXYLIC ACID, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 50mg, 0,5g, 100mg, 250mg, 500mg, 1g.
3,3-dimethyl-1-phenylcyclobutane-1-carboxylic acid (CAS 151157-51-6) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 3,3-dimethyl-1-phenylcyclobutane-1-carboxylic acid. InChIKey: CLSRUFAQOVMBBX-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 3,3-dimethyl-1-phenylcyclobutane-1-carboxylic acid |
| InChIKey | CLSRUFAQOVMBBX-UHFFFAOYSA-N |
| SMILES | CC1(CC(C1)(C2=CC=CC=C2)C(=O)O)C |
Computed by PubChem (NCBI)