CAS 1511867-22-3 appears in our catalog under these names: 4-Methyl-5-nitro-1H-pyrrolo(2,3-b)pyridine, 97%, 4-Methyl-5-nitro-1H-pyrrolo(2,3-b)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine (CAS 1511867-22-3) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 4-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine. InChIKey: DKIWXSVJMQWOMH-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 4-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | DKIWXSVJMQWOMH-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CNC2=NC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)