CAS 1511995-75-7 is the registry number for 5-(1-Methylcyclopropyl)-1,2-oxazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-(1-methylcyclopropyl)-1,2-oxazole-3-carboxylic acid (CAS 1511995-75-7) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 5-(1-methylcyclopropyl)-1,2-oxazole-3-carboxylic acid. InChIKey: ZLGKVVPLBFAAPL-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 5-(1-methylcyclopropyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | ZLGKVVPLBFAAPL-UHFFFAOYSA-N |
| SMILES | CC1(CC1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)