CAS 15121-84-3 appears in our catalog under these names: 2–Nitrophenethyl alcohol, 2-(2-Nitrophenyl)ethanol 98%, 2-NITROPHENETHYL ALCOHOL, 97%, 2-(2-Nitrophenyl)ethanol, 98%, 98%, 2-(2-Nitrophenyl)ethanol, 98%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 10g, 50g, 5g, 1g, 25g, 100g.
2-(2-nitrophenyl)ethanol (CAS 15121-84-3) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2-(2-nitrophenyl)ethanol. InChIKey: SLRIOXRBAPBGEI-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2-(2-nitrophenyl)ethanol |
| InChIKey | SLRIOXRBAPBGEI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)