Products 151250-74-7
CAS 151250-74-7 is the registry number for Levofloxacin Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-6-amino-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid (CAS 151250-74-7) is a chemical compound with the molecular formula C13H11FN2O4 and a molecular weight of 278.24 g/mol. IUPAC name: (2S)-6-amino-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid. InChIKey: RRDZXSXYSBGJCS-YFKPBYRVSA-N.
| Molecular formula | C13H11FN2O4 |
|---|---|
| Molecular weight | 278.24 g/mol |
| IUPAC name | (2S)-6-amino-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| InChIKey | RRDZXSXYSBGJCS-YFKPBYRVSA-N |
| SMILES | C[C@H]1COC2=C3N1C=C(C(=O)C3=CC(=C2N)F)C(=O)O |
Computed by PubChem (NCBI)