Products 1707372-60-8
CAS 1707372-60-8 is the registry number for 4-Ethoxy-1-(4-fluorophenyl)-6-oxo-1,6-dihydropyridazine-3-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-ethoxy-1-(4-fluorophenyl)-6-oxopyridazine-3-carboxylic acid (CAS 1707372-60-8) is a chemical compound with the molecular formula C13H11FN2O4 and a molecular weight of 278.24 g/mol. IUPAC name: 4-ethoxy-1-(4-fluorophenyl)-6-oxopyridazine-3-carboxylic acid. InChIKey: XYBAKAGRJIEKDR-UHFFFAOYSA-N.
| Molecular formula | C13H11FN2O4 |
|---|---|
| Molecular weight | 278.24 g/mol |
| IUPAC name | 4-ethoxy-1-(4-fluorophenyl)-6-oxopyridazine-3-carboxylic acid |
| InChIKey | XYBAKAGRJIEKDR-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=O)N(N=C1C(=O)O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)