CAS 339031-84-4 is the registry number for Ethyl 1-(4-fluorophenyl)-4-hydroxy-6-oxo-1,6-dihydropyridazine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.
Ethyl 1-(4-fluorophenyl)-4-hydroxy-6-oxopyridazine-3-carboxylate (CAS 339031-84-4) is a chemical compound with the molecular formula C13H11FN2O4 and a molecular weight of 278.24 g/mol. IUPAC name: ethyl 1-(4-fluorophenyl)-4-hydroxy-6-oxopyridazine-3-carboxylate. InChIKey: ZUYNPOMQPVLCSK-UHFFFAOYSA-N.
| Molecular formula | C13H11FN2O4 |
|---|---|
| Molecular weight | 278.24 g/mol |
| IUPAC name | ethyl 1-(4-fluorophenyl)-4-hydroxy-6-oxopyridazine-3-carboxylate |
| InChIKey | ZUYNPOMQPVLCSK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C(=O)C=C1O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)