CAS 1239731-56-6 appears in our catalog under these names: [3-(4-Fluoro-2-methoxyphenyl)-6-oxopyridazin-1(6h)-yl]acetic acid, 95%, (3-(4-FLuoro-2-methoxyphenyl)-6-oxopyridazin-1(6h)-yl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[3-(4-fluoro-2-methoxyphenyl)-6-oxopyridazin-1-yl]acetic acid (CAS 1239731-56-6) is a chemical compound with the molecular formula C13H11FN2O4 and a molecular weight of 278.24 g/mol. IUPAC name: 2-[3-(4-fluoro-2-methoxyphenyl)-6-oxopyridazin-1-yl]acetic acid. InChIKey: CUQSHHAJJIBNRC-UHFFFAOYSA-N.
| Molecular formula | C13H11FN2O4 |
|---|---|
| Molecular weight | 278.24 g/mol |
| IUPAC name | 2-[3-(4-fluoro-2-methoxyphenyl)-6-oxopyridazin-1-yl]acetic acid |
| InChIKey | CUQSHHAJJIBNRC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)F)C2=NN(C(=O)C=C2)CC(=O)O |
Computed by PubChem (NCBI)