CAS 1512914-00-9 is the registry number for 2-Methyl-6-nitro-3,4-dihydro-2H-1,4-benzoxazine, 97%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2-methyl-6-nitro-3,4-dihydro-2H-1,4-benzoxazine (CAS 1512914-00-9) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: 2-methyl-6-nitro-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: WTAGNTAYRIAHAZ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 2-methyl-6-nitro-3,4-dihydro-2H-1,4-benzoxazine |
| InChIKey | WTAGNTAYRIAHAZ-UHFFFAOYSA-N |
| SMILES | CC1CNC2=C(O1)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)