CAS 1513145-66-8 appears in our catalog under these names: 4-(3-Bromothiophen-2-yl)-2-chloropyrimidine, 95%, 4-(3-Bromothiophen-2-yl)-2-chloropyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(3-bromothiophen-2-yl)-2-chloropyrimidine (CAS 1513145-66-8) is a chemical compound with the molecular formula C8H4BrClN2S and a molecular weight of 275.55 g/mol. IUPAC name: 4-(3-bromothiophen-2-yl)-2-chloropyrimidine. InChIKey: YBFFZHBVYBKIJC-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClN2S |
|---|---|
| Molecular weight | 275.55 g/mol |
| IUPAC name | 4-(3-bromothiophen-2-yl)-2-chloropyrimidine |
| InChIKey | YBFFZHBVYBKIJC-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1C2=C(C=CS2)Br)Cl |
Computed by PubChem (NCBI)