Products 57709-56-5
CAS 57709-56-5 appears in our catalog under these names: 2-Bromo-5-(2-chlorophenyl)-1,3,4-thiadiazole, 97%, 97%, 2-Bromo-5-(2-chlorophenyl)-1,3,4-thiadiazole, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-bromo-5-(2-chlorophenyl)-1,3,4-thiadiazole (CAS 57709-56-5) is a chemical compound with the molecular formula C8H4BrClN2S and a molecular weight of 275.55 g/mol. IUPAC name: 2-bromo-5-(2-chlorophenyl)-1,3,4-thiadiazole. InChIKey: UGSDMSJROZFOAW-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClN2S |
|---|---|
| Molecular weight | 275.55 g/mol |
| IUPAC name | 2-bromo-5-(2-chlorophenyl)-1,3,4-thiadiazole |
| InChIKey | UGSDMSJROZFOAW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=C(S2)Br)Cl |
Computed by PubChem (NCBI)