CAS 57709-58-7 appears in our catalog under these names: 2-Bromo-5-(4-chlorophenyl)-1,3,4-thiadiazole, 95%, 2-Bromo-5-(4-chlorophenyl)-1,3,4-thiadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-bromo-5-(4-chlorophenyl)-1,3,4-thiadiazole (CAS 57709-58-7) is a chemical compound with the molecular formula C8H4BrClN2S and a molecular weight of 275.55 g/mol. IUPAC name: 2-bromo-5-(4-chlorophenyl)-1,3,4-thiadiazole. InChIKey: BCYOCBCOIDTQRC-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClN2S |
|---|---|
| Molecular weight | 275.55 g/mol |
| IUPAC name | 2-bromo-5-(4-chlorophenyl)-1,3,4-thiadiazole |
| InChIKey | BCYOCBCOIDTQRC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(S2)Br)Cl |
Computed by PubChem (NCBI)