Products 1513866-30-2
CAS 1513866-30-2 is the registry number for 3-(2,6-Difluorophenyl)-3-hydroxypropanenitrile, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3-(2,6-difluorophenyl)-3-hydroxypropanenitrile (CAS 1513866-30-2) is a chemical compound with the molecular formula C9H7F2NO and a molecular weight of 183.15 g/mol. IUPAC name: 3-(2,6-difluorophenyl)-3-hydroxypropanenitrile. InChIKey: MFWUYMMFKXPLDX-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO |
|---|---|
| Molecular weight | 183.15 g/mol |
| IUPAC name | 3-(2,6-difluorophenyl)-3-hydroxypropanenitrile |
| InChIKey | MFWUYMMFKXPLDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(CC#N)O)F |
Computed by PubChem (NCBI)