CAS 1514663-78-5 is the registry number for 8-Hydroxy-6-oxo-1H,3H,4H,6H-pyrido(2,1-c)morpholine-9-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-hydroxy-6-oxo-3,4-dihydro-1H-pyrido[2,1-c][1,4]oxazine-9-carboxylic acid (CAS 1514663-78-5) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 8-hydroxy-6-oxo-3,4-dihydro-1H-pyrido[2,1-c][1,4]oxazine-9-carboxylic acid. InChIKey: AFNYJEJIPBGFEG-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 8-hydroxy-6-oxo-3,4-dihydro-1H-pyrido[2,1-c][1,4]oxazine-9-carboxylic acid |
| InChIKey | AFNYJEJIPBGFEG-UHFFFAOYSA-N |
| SMILES | C1COCC2=C(C(=CC(=O)N21)O)C(=O)O |
Computed by PubChem (NCBI)