CAS 15151-14-1 is the registry number for rac-2-Methyl-4-phenyl-4H-pyrano(3,2-c)benzopyran-5-one. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
2-methyl-4-phenyl-4H-pyrano[3,2-c]chromen-5-one (CAS 15151-14-1) is a chemical compound with the molecular formula C19H14O3 and a molecular weight of 290.3 g/mol. IUPAC name: 2-methyl-4-phenyl-4H-pyrano[3,2-c]chromen-5-one. InChIKey: KMPSOFDQEUDDIF-UHFFFAOYSA-N.
| Molecular formula | C19H14O3 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 2-methyl-4-phenyl-4H-pyrano[3,2-c]chromen-5-one |
| InChIKey | KMPSOFDQEUDDIF-UHFFFAOYSA-N |
| SMILES | CC1=CC(C2=C(O1)C3=CC=CC=C3OC2=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)