CAS 586989-72-2 is the registry number for 3,4-Diphenoxybenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-diphenoxybenzaldehyde (CAS 586989-72-2) is a chemical compound with the molecular formula C19H14O3 and a molecular weight of 290.3 g/mol. IUPAC name: 3,4-diphenoxybenzaldehyde. InChIKey: DFFHATHVIPXZOI-UHFFFAOYSA-N.
| Molecular formula | C19H14O3 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 3,4-diphenoxybenzaldehyde |
| InChIKey | DFFHATHVIPXZOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)C=O)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)