CAS 35187-29-2 is the registry number for 2-(4-Methyl-1-naphthoyl)benzoic Acid. Offered by: TRC. Available pack sizes: 1g.
2-(4-methylnaphthalene-1-carbonyl)benzoic acid (CAS 35187-29-2) is a chemical compound with the molecular formula C19H14O3 and a molecular weight of 290.3 g/mol. IUPAC name: 2-(4-methylnaphthalene-1-carbonyl)benzoic acid. InChIKey: ILZBGGYAYBHVGB-UHFFFAOYSA-N.
| Molecular formula | C19H14O3 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 2-(4-methylnaphthalene-1-carbonyl)benzoic acid |
| InChIKey | ILZBGGYAYBHVGB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C2=CC=CC=C12)C(=O)C3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)